MePAA
N-Methyl-4-[2-(methylamino)propyl]aniline
 6230  C11H18N2  178.274
 InChI=1S/C11H18N2/c1-9(12-2)8-10-4-6-11(13-3)7-5-10/h4-7,9,12-13H,8H2,1-3H3
 OKNUMVZRGVGMQM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc(cc1)NC)C