4-Br-PEA
2-(4-Bromophenyl)ethan-1-amine
 6222  C8H10BrN  200.076
 InChI=1S/C8H10BrN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2
 ZSZCXAOQVBEPME-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1)Br