iPr-NKE-Pent
Propan-2-yl 5-{[1-(2-chlorophenyl)-2-oxocyclohexyl]amino}pentanoate
 6221 C20H28ClNO3 365.894
 Arylcycloalkylamine
 InChI=1S/C20H28ClNO3/c1-15(2)25-19(24)12-6-8-14-22-20(13-7-5-11-18(20)23)16-9-3-4-10-17(16)21/h3-4,9-10,15,22H,5-8,11-14H2,1-2H3
 VELFQRXGQQEDQS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(OC(=O)CCCCNC1(CCCCC1=O)c1ccccc1Cl)C