N-Et-PCA
2-(4-Chlorophenyl)-N-ethylethan-1-amine
 6217  C10H14ClN  183.678
 InChI=1S/C10H14ClN/c1-2-12-8-7-9-3-5-10(11)6-4-9/h3-6,12H,2,7-8H2,1H3
 QUVTTYBFMDDFBM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCc1ccc(cc1)Cl