4-FPEA
2-(4-Fluorophenyl)ethan-1-amine
 6207  C8H10FN  139.17
 InChI=1S/C8H10FN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2
 CKLFJWXRWIQYOC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1)F