3-MTA
1-[3-(Methylsulfanyl)phenyl]propan-2-amine
 6206  C10H15NS  181.298
 InChI=1S/C10H15NS/c1-8(11)6-9-4-3-5-10(7-9)12-2/h3-5,7-8H,6,11H2,1-2H3
 IOYQOOUTHXXDIC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CSc1cccc(c1)CC(N)C