3-EA
1-(3-Ethoxyphenyl)propan-2-amine
 6203 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-3-13-11-6-4-5-10(8-11)7-9(2)12/h4-6,8-9H,3,7,12H2,1-2H3
 JGKHSWSCGNUEGQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cccc(c1)CC(N)C