2-MTA
1-[2-(Methylsulfanyl)phenyl]propan-2-amine
 6120 C10H15NS 181.298
 InChI=1S/C10H15NS/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6,8H,7,11H2,1-2H3
 VGKAKJXMHGNTFY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CSc1ccccc1CC(N)C