N-mor-2-MA
4-[1-(2-Methoxyphenyl)propan-2-yl]morpholine
 6113 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-12(15-7-9-17-10-8-15)11-13-5-3-4-6-14(13)16-2/h3-6,12H,7-11H2,1-2H3
 FBHHJANCRCAJCC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CC(N1CCOCC1)C