N-iPr-2-MA
1-(2-Methoxyphenyl)-N-(propan-2-yl)propan-2-amine
 6108  C13H21NO  207.312
 InChI=1S/C13H21NO/c1-10(2)14-11(3)9-12-7-5-6-8-13(12)15-4/h5-8,10-11,14H,9H2,1-4H3
 VIWVDXYATJDPPN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CC(NC(C)C)C