N,N-Et-2-MA
N,N-Diethyl-1-(2-methoxyphenyl)propan-2-amine
 6107 C14H23NO 221.339
 InChI=1S/C14H23NO/c1-5-15(6-2)12(3)11-13-9-7-8-10-14(13)16-4/h7-10,12H,5-6,11H2,1-4H3
 OOIDQNORPFCTPM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(Cc1ccccc1OC)C)CC