β,N-Me-2-MPEA
2-(2-Methoxyphenyl)-N-methylpropan-1-amine
 6082 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-9(8-12-2)10-6-4-5-7-11(10)13-3/h4-7,9,12H,8H2,1-3H3
 UEFYTJOXDDAYAC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1ccccc1OC)C