N,N-Me-2-MPEA
2-(2-Methoxyphenyl)-N,N-dimethylethan-1-amine
 6080 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-12(2)9-8-10-6-4-5-7-11(10)13-3/h4-7H,8-9H2,1-3H3
 OJBKIDQVHLJFAJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CCN(C)C