homo-PMA
4-(4-Methoxyphenyl)butan-2-amine
 606 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-9(12)3-4-10-5-7-11(13-2)8-6-10/h5-9H,3-4,12H2,1-2H3
 JMHAKVPFYWWNOW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)CCC(N)C