homo-β,N-MePEA
N,2-Dimethyl-3-phenylpropan-1-amine
 602 C11H17N 163.259
 InChI=1S/C11H17N/c1-10(9-12-2)8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3
 QAWKZRYBSNVOAF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(Cc1ccccc1)C