β-Me-N-Et-PEA
N-Ethyl-2-phenylpropan-1-amine
 6009 C11H17N 163.259
 InChI=1S/C11H17N/c1-3-12-9-10(2)11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3
 YRJYTEMOKSUBHJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCC(c1ccccc1)C