N-iPrPEA
N-(2-Phenylethyl)propan-2-amine
 6006 C11H17N 163.259
 InChI=1S/C11H17N/c1-10(2)12-9-8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3
 HNPAEWJKFXEUDW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NCCc1ccccc1)C