DOMeSOEt
1-{4-[2-(Methanesulfinyl)ethyl]-2,5-dimethoxyphenyl}propan-2-amine
 5996  C14H23NO3S  285.402
 InChI=1S/C14H23NO3S/c1-10(15)7-12-9-13(17-2)11(5-6-19(4)16)8-14(12)18-3/h8-10H,5-7,15H2,1-4H3
 UHUFCDKBUOPDAA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(cc1CCS(=O)C)OC