5-Ac-DOM
5-(2-Aminopropyl)-4-methoxy-2-methylphenyl acetate
 5989 C13H19NO3 237.295
 InChI=1S/C13H19NO3/c1-8-5-13(16-4)11(6-9(2)14)7-12(8)17-10(3)15/h5,7,9H,6,14H2,1-4H3
 KCWXEKKJYWFWDV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1CC(N)C)OC(=O)C