DOMeOPr
1-[2,5-Dimethoxy-4-(3-methoxypropyl)phenyl]propan-2-amine
 5986 C15H25NO3 267.364
 InChI=1S/C15H25NO3/c1-11(16)8-13-10-14(18-3)12(6-5-7-17-2)9-15(13)19-4/h9-11H,5-8,16H2,1-4H3
 LDOQQKLUNHIUJW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COCCCc1cc(OC)c(cc1OC)CC(N)C