DOMeSEt
1-{2,5-Dimethoxy-4-[2-(methylsulfanyl)ethyl]phenyl}propan-2-amine
 5984 C14H23NO2S 269.403
 InChI=1S/C14H23NO2S/c1-10(15)7-12-9-13(16-2)11(5-6-18-4)8-14(12)17-3/h8-10H,5-7,15H2,1-4H3
 MDLPCKNFDCESEM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CSCCc1cc(OC)c(cc1OC)CC(N)C