2C-B-5-MeOEtO
2-[4-Bromo-2-methoxy-5-(2-methoxyethoxy)phenyl]ethan-1-amine
 5969 C12H18BrNO3 304.18
 InChI=1S/C12H18BrNO3/c1-15-5-6-17-12-7-9(3-4-14)11(16-2)8-10(12)13/h7-8H,3-6,14H2,1-2H3
 ANDPSAIBNZGNOO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COCCOc1cc(CCN)c(cc1Br)OC