2C-MOM
2-[2,5-Dimethoxy-4-(methoxymethyl)phenyl]ethan-1-amine
 5963 C12H19NO3 225.284
 Prophetic?
 InChI=1S/C12H19NO3/c1-14-8-10-7-11(15-2)9(4-5-13)6-12(10)16-3/h6-7H,4-5,8,13H2,1-3H3
 FPYLIKAGUKYUOX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COCc1cc(OC)c(cc1OC)CCN