2C-THF2
2-[2,5-Dimethoxy-4-(oxolan-2-yl)phenyl]ethan-1-amine
 5961 C14H21NO3 251.321
 InChI=1S/C14H21NO3/c1-16-13-9-11(12-4-3-7-18-12)14(17-2)8-10(13)5-6-15/h8-9,12H,3-7,15H2,1-2H3
 WDVKWJCFYZHIOI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C1CCCO1