5-DM-25B-NBOMe
2-Bromo-4-methoxy-5-(2-{[(2-methoxyphenyl)methyl]amino}ethyl)phenol
 5952  C17H20BrNO3  366.25
 InChI=1S/C17H20BrNO3/c1-21-16-6-4-3-5-13(16)11-19-8-7-12-9-15(20)14(18)10-17(12)22-2/h3-6,9-10,19-20H,7-8,11H2,1-2H3
 IVVHUBRWCYPDHE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(cc1CCNCc1ccccc1OC)O