2C-OXET-3
2-[2,5-Dimethoxy-4-(oxetan-3-yl)phenyl]ethan-1-amine
 5951 C13H19NO3 237.295
 Prophetic?
 InChI=1S/C13H19NO3/c1-15-12-6-11(10-7-17-8-10)13(16-2)5-9(12)3-4-14/h5-6,10H,3-4,7-8,14H2,1-2H3
 FGGLDVOSWPJZJY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C1COC1