5-BnO-NMT
2-[5-(Benzyloxy)-1H-indol-3-yl]-N-methylethan-1-amine
 5867  C18H20N2O  280.364
 InChI=1S/C18H20N2O/c1-19-10-9-15-12-20-18-8-7-16(11-17(15)18)21-13-14-5-3-2-4-6-14/h2-8,11-12,19-20H,9-10,13H2,1H3
 IWCCYXGZEMLZKS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1c[nH]c2c1cc(OCc1ccccc1)cc2