1-[5-(Benzyloxy)-1H-indol-3-yl]-N,N-dimethylpropan-2-amine
 5835  C20H24N2O  308.417
 InChI=1S/C20H24N2O/c1-15(22(2)3)11-17-13-21-20-10-9-18(12-19(17)20)23-14-16-7-5-4-6-8-16/h4-10,12-13,15,21H,11,14H2,1-3H3
 CJHZNUHKDXJZGU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1c[nH]c2c1cc(OCc1ccccc1)cc2)C)C