1-[5-(Benzyloxy)-1H-indol-3-yl]-N-ethylpropan-2-amine
 5832  C20H24N2O  308.417
 InChI=1S/C20H24N2O/c1-3-21-15(2)11-17-13-22-20-10-9-18(12-19(17)20)23-14-16-7-5-4-6-8-16/h4-10,12-13,15,21-22H,3,11,14H2,1-2H3
 SEUSVSXMONQSSE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1c[nH]c2c1cc(OCc1ccccc1)cc2)C