1-[5-(Benzyloxy)-1H-indol-3-yl]-N-methylpropan-2-amine
 5831  C19H22N2O  294.391
 InChI=1S/C19H22N2O/c1-14(20-2)10-16-12-21-19-9-8-17(11-18(16)19)22-13-15-6-4-3-5-7-15/h3-9,11-12,14,20-21H,10,13H2,1-2H3
 OBEGMGUMICBUDZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1c[nH]c2c1cc(OCc1ccccc1)cc2)C