1-[5-(2-Phenylethoxy)-1H-indol-3-yl]propan-2-amine
 5824  C19H22N2O  294.391
 InChI=1S/C19H22N2O/c1-14(20)11-16-13-21-19-8-7-17(12-18(16)19)22-10-9-15-5-3-2-4-6-15/h2-8,12-14,21H,9-11,20H2,1H3
 STYJEBNXUNRKKR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c[nH]c2c1cc(OCCc1ccccc1)cc2)N