1-[5-(Benzyloxy)-1H-indol-3-yl]propan-2-amine
 5806  C18H20N2O  280.364
 InChI=1S/C18H20N2O/c1-13(19)9-15-11-20-18-8-7-16(10-17(15)18)21-12-14-5-3-2-4-6-14/h2-8,10-11,13,20H,9,12,19H2,1H3
 VZEOVICMIOOXPI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c[nH]c2c1cc(OCc1ccccc1)cc2)N