SBat
1-[8-(Methylsulfanyl)-2,3,5,6-tetrahydrobenzo[1,2-b:5,4-b′]difuran-4-yl]propan-2-amine
 580 C14H19NO2S 265.371
 InChI=1S/C14H19NO2S/c1-8(15)7-11-9-3-5-16-12(9)14(18-2)13-10(11)4-6-17-13/h8H,3-7,15H2,1-2H3
 QFWFDIPLJVMAFN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CSc1c2OCCc2c(c2c1OCC2)CC(N)C