BBat
1-(8-Bromo-2,3,5,6-tetrahydrobenzo[1,2-b:5,4-b′]difuran-4-yl)propan-2-amine
 579 C13H16BrNO2 298.176
 InChI=1S/C13H16BrNO2/c1-7(15)6-10-8-2-4-16-12(8)11(14)13-9(10)3-5-17-13/h7H,2-6,15H2,1H3
 FBAGZAPMZZYRFN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c2CCOc2c(c2c1CCO2)Br)N