5-MeO-DIBF
N-[2-(5-Methoxy-1-benzofuran-3-yl)ethyl]-N-(propan-2-yl)propan-2-amine
 5771 C17H25NO2 275.386
 InChI=1S/C17H25NO2/c1-12(2)18(13(3)4)9-8-14-11-20-17-7-6-15(19-5)10-16(14)17/h6-7,10-13H,8-9H2,1-5H3
 NBFMSQBTYHYVKP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(C(C)C)C(C)C)co2