6-HO-AMT
3-(2-Aminopropyl)-1H-indol-6-ol
 5733  C11H14N2O  190.242
 InChI=1S/C11H14N2O/c1-7(12)4-8-6-13-11-5-9(14)2-3-10(8)11/h2-3,5-7,13-14H,4,12H2,1H3
 ZMYHMMLZVYSRPA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c[nH]c2c1ccc(c2)O)N