5,6-HO-7-Me-T
3-(2-Aminoethyl)-7-methyl-1H-indole-5,6-diol
 5730  C11H14N2O2  206.241
 InChI=1S/C11H14N2O2/c1-6-10-8(4-9(14)11(6)15)7(2-3-12)5-13-10/h4-5,13-15H,2-3,12H2,1H3
 VWUOXRPBZMPVCU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c[nH]c2c1cc(O)c(c2C)O