N-[2-(5-Methoxy-1H-indol-3-yl)ethyl]-N-methylprop-2-yn-1-amine
 5696  C15H18N2O  242.316
 InChI=1S/C15H18N2O/c1-4-8-17(2)9-7-12-11-16-15-6-5-13(18-3)10-14(12)15/h1,5-6,10-11,16H,7-9H2,2-3H3
 RIRUSTVUQBBBEU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CC#C)CCc1c[nH]c2c1cc(OC)cc2