2-(5-Methoxy-1H-indol-3-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-methylethan-1-amine
 5678 C23H27N3O2 377.479
 InChI=1S/C23H27N3O2/c1-26(10-8-16-14-24-22-6-4-18(27-2)12-20(16)22)11-9-17-15-25-23-7-5-19(28-3)13-21(17)23/h4-7,12-15,24-25H,8-11H2,1-3H3
 VJNJLYMIRMVCAQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(CCN(CCc1c[nH]c3c1cc(OC)cc3)C)c[nH]2