2-(1H-Indol-3-yl)-N-[2-(4-methoxyphenyl)ethyl]-N-methylethan-1-amine
 5620  C20H24N2O  308.417
 InChI=1S/C20H24N2O/c1-22(13-11-16-7-9-18(23-2)10-8-16)14-12-17-15-21-20-6-4-3-5-19(17)20/h3-10,15,21H,11-14H2,1-2H3
 JSKDTSUBDZJHNK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)CCN(CCc1c[nH]c2c1cccc2)C