2-(1H-Indol-3-yl)-N-[2-(3-methoxyphenyl)ethyl]-N-methylethan-1-amine
 5613  C20H24N2O  308.417
 InChI=1S/C20H24N2O/c1-22(12-10-16-6-5-7-18(14-16)23-2)13-11-17-15-21-20-9-4-3-8-19(17)20/h3-9,14-15,21H,10-13H2,1-2H3
 WVNPOYRYRQPFAD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cccc(c1)CCN(CCc1c[nH]c2c1cccc2)C