5-EtO-MET
2-(5-Ethoxy-1H-indol-3-yl)-N-ethyl-N-methylethan-1-amine
 5594 C15H22N2O 246.348
 InChI=1S/C15H22N2O/c1-4-17(3)9-8-12-11-16-15-7-6-13(18-5-2)10-14(12)15/h6-7,10-11,16H,4-5,8-9H2,1-3H3
 KCPQLNQEAJVBMZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc2c(c1)c(CCN(CC)C)c[nH]2