5-MeO-2-Me-MET
N-Ethyl-2-(5-methoxy-2-methyl-1H-indol-3-yl)-N-methylethan-1-amine
 5580 C15H22N2O 246.348
 InChI=1S/C15H22N2O/c1-5-17(3)9-8-13-11(2)16-15-7-6-12(18-4)10-14(13)15/h6-7,10,16H,5,8-9H2,1-4H3
 BSGSJOSGZBFOPP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c(C)[nH]c2c1cc(OC)cc2)C