6-Methoxy-N,N-dimethyl-2a,3,4,5-tetrahydro-2H-naphtho[1,8-bc]furan-4-amine
 555 C14H19NO2 233.306
 InChI=1S/C14H19NO2/c1-15(2)10-6-9-8-17-13-5-4-12(16-3)11(7-10)14(9)13/h4-5,9-10H,6-8H2,1-3H3
 NRQKPYBPFDFAAT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c3c1CC(CC3CO2)N(C)C