5-MeO-1-Pr-AMT
1-(5-Methoxy-1-propyl-1H-indol-3-yl)propan-2-amine
 5458 C15H22N2O 246.348
 InChI=1S/C15H22N2O/c1-4-7-17-10-12(8-11(2)16)14-9-13(18-3)5-6-15(14)17/h5-6,9-11H,4,7-8,16H2,1-3H3
 DAGLCFOMYRIMJJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCn1cc(c2c1ccc(c2)OC)CC(N)C