1-(6-Methoxy-4,5-dihydro-3H-naphtho[1,8-bc]furan-5-yl)methanamine
 5219 C13H15NO2 217.264
 InChI=1S/C13H15NO2/c1-15-10-4-5-11-13-9(7-16-11)3-2-8(6-14)12(10)13/h4-5,7-8H,2-3,6,14H2,1H3
 JQWMJWBECNKMTK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1CCc2c3c1c(OC)ccc3oc2