3,4-DHO-CPA
4-(2-Aminocyclopropyl)benzene-1,2-diol
 506  C9H11NO2  165.189
 InChI=1S/C9H11NO2/c10-7-4-6(7)5-1-2-8(11)9(12)3-5/h1-3,6-7,11-12H,4,10H2
 YZVQPNOCOJHXGZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CC1c1ccc(c(c1)O)O