CBD-7-COOH
(1R,6R)-2′,6′-Dihydroxy-4′-pentyl-6-(prop-1-en-2-yl)-1,4,5,6-tetrahydro[1,1′-biphenyl]-3-carboxylic acid
 4985 C21H28O4 344.445
 Cannabinoid
 InChI=1S/C21H28O4/c1-4-5-6-7-14-10-18(22)20(19(23)11-14)17-12-15(21(24)25)8-9-16(17)13(2)3/h10-12,16-17,22-23H,2,4-9H2,1,3H3,(H,24,25)/t16-,17+/m0/s1
 LQHAPFLIUQWVJR-DLBZAZTESA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c(c(c1)O)[C@@H]1C=C(CC[C@H]1C(=C)C)C(=O)O