O-1602
(1′R,2′R)-5′,6-Dimethyl-2′-(prop-1-en-2-yl)-1′,2′,3′,4′-tetrahydro[1,1′-biphenyl]-2,4-diol
 4978 C17H22O2 258.355
 Cannabinoid
 InChI=1S/C17H22O2/c1-10(2)14-6-5-11(3)7-15(14)17-12(4)8-13(18)9-16(17)19/h7-9,14-15,18-19H,1,5-6H2,2-4H3/t14-,15+/m0/s1
 KDZOUSULXZNDJH-LSDHHAIUSA-N This stereoisomer Any stereoisomer
 CC1=C[C@H]([C@@H](CC1)C(=C)C)c1c(C)cc(cc1O)O