C7-CBD
(1′R,2′R)-4-Heptyl-5′-methyl-2′-(prop-1-en-2-yl)-1′,2′,3′,4′-tetrahydro[1,1′-biphenyl]-2,6-diol
 4972 C23H34O2 342.515
 Cannabinoid
 InChI=1S/C23H34O2/c1-5-6-7-8-9-10-18-14-21(24)23(22(25)15-18)20-13-17(4)11-12-19(20)16(2)3/h13-15,19-20,24-25H,2,5-12H2,1,3-4H3/t19-,20+/m0/s1
 GGHRHCGOMWNLCE-VQTJNVASSA-N This stereoisomer Any stereoisomer
 CCCCCCCc1cc(O)c(c(c1)O)[C@@H]1C=C(C)CC[C@H]1C(=C)C